C12H11F3N2OS — CID 105097071
(4-propylthiadiazol-5-yl)-(2,3,4-trifluorophenyl)methanol (PubChem CID 105097071) has the molecular formula C12H11F3N2OS and a molecular weight of 288.29 g/mol. Its IUPAC name is (4-propylthiadiazol-5-yl)-(2,3,4-trifluorophenyl)methanol.
| Compound Name | (4-propylthiadiazol-5-yl)-(2,3,4-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 105097071 |
| Molecular Formula | C12H11F3N2OS |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | (4-propylthiadiazol-5-yl)-(2,3,4-trifluorophenyl)methanol |
| SMILES | CCCc1nnsc1C(O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H11F3N2OS/c1-2-3-8-12(19-17-16-8)11(18)6-4-5-7(13)10(15)9(6)14/h4-5,11,18H,2-3H2,1H3 |
| InChIKey | MRNQGXLYGRKQPN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|