C10H12N2OS2 — CID 105079979
(4-propylthiadiazol-5-yl)-thiophen-2-ylmethanol (PubChem CID 105079979) has the molecular formula C10H12N2OS2 and a molecular weight of 240.35 g/mol. Its IUPAC name is (4-propylthiadiazol-5-yl)-thiophen-2-ylmethanol.
| Compound Name | (4-propylthiadiazol-5-yl)-thiophen-2-ylmethanol |
|---|---|
| PubChem CID | 105079979 |
| Molecular Formula | C10H12N2OS2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | (4-propylthiadiazol-5-yl)-thiophen-2-ylmethanol |
| SMILES | CCCc1nnsc1C(O)c1cccs1 |
| InChI | InChI=1S/C10H12N2OS2/c1-2-4-7-10(15-12-11-7)9(13)8-5-3-6-14-8/h3,5-6,9,13H,2,4H2,1H3 |
| InChIKey | NHPQUMCEOWAIST-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |