C14H18N2OS — CID 105131044
(4-ethylthiadiazol-5-yl)-(3-propylphenyl)methanol (PubChem CID 105131044) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is (4-ethylthiadiazol-5-yl)-(3-propylphenyl)methanol.
| Compound Name | (4-ethylthiadiazol-5-yl)-(3-propylphenyl)methanol |
|---|---|
| PubChem CID | 105131044 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (4-ethylthiadiazol-5-yl)-(3-propylphenyl)methanol |
| SMILES | CCCc1cccc(C(O)c2snnc2CC)c1 |
| InChI | InChI=1S/C14H18N2OS/c1-3-6-10-7-5-8-11(9-10)13(17)14-12(4-2)15-16-18-14/h5,7-9,13,17H,3-4,6H2,1-2H3 |
| InChIKey | QRGOKRSIXTXHNH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |