C11H11BrN2O4 — CID 106886347
(3-bromofuran-2-yl)-(3,5-dimethoxypyrazin-2-yl)methanol (PubChem CID 106886347) has the molecular formula C11H11BrN2O4 and a molecular weight of 315.12 g/mol. Its IUPAC name is (3-bromofuran-2-yl)-(3,5-dimethoxypyrazin-2-yl)methanol.
| Compound Name | (3-bromofuran-2-yl)-(3,5-dimethoxypyrazin-2-yl)methanol |
|---|---|
| PubChem CID | 106886347 |
| Molecular Formula | C11H11BrN2O4 |
| Molecular Weight | 315.12 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | (3-bromofuran-2-yl)-(3,5-dimethoxypyrazin-2-yl)methanol |
| SMILES | COc1cnc(C(O)c2occc2Br)c(OC)n1 |
| InChI | InChI=1S/C11H11BrN2O4/c1-16-7-5-13-8(11(14-7)17-2)9(15)10-6(12)3-4-18-10/h3-5,9,15H,1-2H3 |
| InChIKey | NFUXWXACZMRDDA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 77.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.12 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |