C13H12Br2O4 — CID 63941832
(2-bromo-4,5-dimethoxyphenyl)-(3-bromofuran-2-yl)methanol (PubChem CID 63941832) has the molecular formula C13H12Br2O4 and a molecular weight of 392.04 g/mol. Its IUPAC name is (2-bromo-4,5-dimethoxyphenyl)-(3-bromofuran-2-yl)methanol.
| Compound Name | (2-bromo-4,5-dimethoxyphenyl)-(3-bromofuran-2-yl)methanol |
|---|---|
| PubChem CID | 63941832 |
| Molecular Formula | C13H12Br2O4 |
| Molecular Weight | 392.04 g/mol |
| Exact Mass | 389.91 |
| IUPAC Name | (2-bromo-4,5-dimethoxyphenyl)-(3-bromofuran-2-yl)methanol |
| SMILES | COc1cc(Br)c(C(O)c2occc2Br)cc1OC |
| InChI | InChI=1S/C13H12Br2O4/c1-17-10-5-7(9(15)6-11(10)18-2)12(16)13-8(14)3-4-19-13/h3-6,12,16H,1-2H3 |
| InChIKey | FXTTVTFZMJHIBH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.04 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |