C14H15BrO4 — CID 61088712
(2-bromo-4,5-dimethoxyphenyl)-(2-methylfuran-3-yl)methanol (PubChem CID 61088712) has the molecular formula C14H15BrO4 and a molecular weight of 327.17 g/mol. Its IUPAC name is (2-bromo-4,5-dimethoxyphenyl)-(2-methylfuran-3-yl)methanol.
| Compound Name | (2-bromo-4,5-dimethoxyphenyl)-(2-methylfuran-3-yl)methanol |
|---|---|
| PubChem CID | 61088712 |
| Molecular Formula | C14H15BrO4 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | (2-bromo-4,5-dimethoxyphenyl)-(2-methylfuran-3-yl)methanol |
| SMILES | COc1cc(Br)c(C(O)c2ccoc2C)cc1OC |
| InChI | InChI=1S/C14H15BrO4/c1-8-9(4-5-19-8)14(16)10-6-12(17-2)13(18-3)7-11(10)15/h4-7,14,16H,1-3H3 |
| InChIKey | VKQPLKUGRKLURU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |