C13H11F3N2O — CID 105026146
(5-methoxy-3-pyridinyl)-(2,4,6-trifluorophenyl)methanamine (PubChem CID 105026146) has the molecular formula C13H11F3N2O and a molecular weight of 268.24 g/mol. Its IUPAC name is (5-methoxy-3-pyridinyl)-(2,4,6-trifluorophenyl)methanamine.
| Compound Name | (5-methoxy-3-pyridinyl)-(2,4,6-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 105026146 |
| Molecular Formula | C13H11F3N2O |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | (5-methoxy-3-pyridinyl)-(2,4,6-trifluorophenyl)methanamine |
| SMILES | COc1cncc(C(N)c2c(F)cc(F)cc2F)c1 |
| InChI | InChI=1S/C13H11F3N2O/c1-19-9-2-7(5-18-6-9)13(17)12-10(15)3-8(14)4-11(12)16/h2-6,13H,17H2,1H3 |
| InChIKey | NKFPSICMMAMKEI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |