C11H13NO2S — CID 130543309
(2-methoxy-3-pyridinyl)-(thiolan-3-yl)methanone (PubChem CID 130543309) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is (2-methoxy-3-pyridinyl)-(thiolan-3-yl)methanone.
| Compound Name | (2-methoxy-3-pyridinyl)-(thiolan-3-yl)methanone |
|---|---|
| PubChem CID | 130543309 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | (2-methoxy-3-pyridinyl)-(thiolan-3-yl)methanone |
| SMILES | COc1ncccc1C(=O)C1CCSC1 |
| InChI | InChI=1S/C11H13NO2S/c1-14-11-9(3-2-5-12-11)10(13)8-4-6-15-7-8/h2-3,5,8H,4,6-7H2,1H3 |
| InChIKey | AJYLKCOBJDNFON-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |