C12H17NOS2 — CID 103595167
1-(4-methylthiomorpholin-3-yl)-3-thiophen-3-ylpropan-1-one (PubChem CID 103595167) has the molecular formula C12H17NOS2 and a molecular weight of 255.41 g/mol. Its IUPAC name is 1-(4-methylthiomorpholin-3-yl)-3-thiophen-3-ylpropan-1-one.
| Compound Name | 1-(4-methylthiomorpholin-3-yl)-3-thiophen-3-ylpropan-1-one |
|---|---|
| PubChem CID | 103595167 |
| Molecular Formula | C12H17NOS2 |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 1-(4-methylthiomorpholin-3-yl)-3-thiophen-3-ylpropan-1-one |
| SMILES | CN1CCSCC1C(=O)CCc1ccsc1 |
| InChI | InChI=1S/C12H17NOS2/c1-13-5-7-16-9-11(13)12(14)3-2-10-4-6-15-8-10/h4,6,8,11H,2-3,5,7,9H2,1H3 |
| InChIKey | OFTDEBIKKRHENN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |