C10H5BrF2N2OS — CID 106267390
2-(3-bromo-2,6-difluorophenyl)-1-(thiadiazol-5-yl)ethanone (PubChem CID 106267390) has the molecular formula C10H5BrF2N2OS and a molecular weight of 319.13 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(thiadiazol-5-yl)ethanone.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(thiadiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 106267390 |
| Molecular Formula | C10H5BrF2N2OS |
| Molecular Weight | 319.13 g/mol |
| Exact Mass | 317.93 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(thiadiazol-5-yl)ethanone |
| SMILES | O=C(Cc1c(F)ccc(Br)c1F)c1cnns1 |
| InChI | InChI=1S/C10H5BrF2N2OS/c11-6-1-2-7(12)5(10(6)13)3-8(16)9-4-14-15-17-9/h1-2,4H,3H2 |
| InChIKey | CYPGNOHMPRUAON-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.13 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|