C9H3BrF2N2OS — CID 106944362
(3-bromo-2,6-difluorophenyl)-(thiadiazol-5-yl)methanone (PubChem CID 106944362) has the molecular formula C9H3BrF2N2OS and a molecular weight of 305.10 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)-(thiadiazol-5-yl)methanone.
| Compound Name | (3-bromo-2,6-difluorophenyl)-(thiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 106944362 |
| Molecular Formula | C9H3BrF2N2OS |
| Molecular Weight | 305.10 g/mol |
| Exact Mass | 303.91 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)-(thiadiazol-5-yl)methanone |
| SMILES | O=C(c1cnns1)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C9H3BrF2N2OS/c10-4-1-2-5(11)7(8(4)12)9(15)6-3-13-14-16-6/h1-3H |
| InChIKey | SODYNWQDODBOED-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.10 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|