C13H11BrF2N2OS — CID 106944355
(3-bromo-2,6-difluorophenyl)-(4-tert-butylthiadiazol-5-yl)methanone (PubChem CID 106944355) has the molecular formula C13H11BrF2N2OS and a molecular weight of 361.21 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)-(4-tert-butylthiadiazol-5-yl)methanone.
| Compound Name | (3-bromo-2,6-difluorophenyl)-(4-tert-butylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 106944355 |
| Molecular Formula | C13H11BrF2N2OS |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)-(4-tert-butylthiadiazol-5-yl)methanone |
| SMILES | CC(C)(C)c1nnsc1C(=O)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H11BrF2N2OS/c1-13(2,3)12-11(20-18-17-12)10(19)8-7(15)5-4-6(14)9(8)16/h4-5H,1-3H3 |
| InChIKey | DDTNHXPGMFOMMW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|