C14H10Br2O — CID 114962947
(2,5-dibromophenyl)-(2-methylphenyl)methanone (PubChem CID 114962947) has the molecular formula C14H10Br2O and a molecular weight of 354.04 g/mol. Its IUPAC name is (2,5-dibromophenyl)-(2-methylphenyl)methanone.
| Compound Name | (2,5-dibromophenyl)-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 114962947 |
| Molecular Formula | C14H10Br2O |
| Molecular Weight | 354.04 g/mol |
| Exact Mass | 351.91 |
| IUPAC Name | (2,5-dibromophenyl)-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C14H10Br2O/c1-9-4-2-3-5-11(9)14(17)12-8-10(15)6-7-13(12)16/h2-8H,1H3 |
| InChIKey | QZCSBLUBGNAIQA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.04 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |