C14H11Br2NO — CID 47167937
N-(2,5-dibromophenyl)-2-methylbenzamide (PubChem CID 47167937) has the molecular formula C14H11Br2NO and a molecular weight of 369.06 g/mol. Its IUPAC name is N-(2,5-dibromophenyl)-2-methylbenzamide.
| Compound Name | N-(2,5-dibromophenyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 47167937 |
| Molecular Formula | C14H11Br2NO |
| Molecular Weight | 369.06 g/mol |
| Exact Mass | 366.92 |
| IUPAC Name | N-(2,5-dibromophenyl)-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1cc(Br)ccc1Br |
| InChI | InChI=1S/C14H11Br2NO/c1-9-4-2-3-5-11(9)14(18)17-13-8-10(15)6-7-12(13)16/h2-8H,1H3,(H,17,18) |
| InChIKey | IACFTSFSADGQKQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.06 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |