C14H11Br2FN2O — CID 103296247
5-amino-N-(2,5-dibromophenyl)-2-fluoro-3-methylbenzamide (PubChem CID 103296247) has the molecular formula C14H11Br2FN2O and a molecular weight of 402.06 g/mol. Its IUPAC name is 5-amino-N-(2,5-dibromophenyl)-2-fluoro-3-methylbenzamide.
| Compound Name | 5-amino-N-(2,5-dibromophenyl)-2-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 103296247 |
| Molecular Formula | C14H11Br2FN2O |
| Molecular Weight | 402.06 g/mol |
| Exact Mass | 399.92 |
| IUPAC Name | 5-amino-N-(2,5-dibromophenyl)-2-fluoro-3-methylbenzamide |
| SMILES | Cc1cc(N)cc(C(=O)Nc2cc(Br)ccc2Br)c1F |
| InChI | InChI=1S/C14H11Br2FN2O/c1-7-4-9(18)6-10(13(7)17)14(20)19-12-5-8(15)2-3-11(12)16/h2-6H,18H2,1H3,(H,19,20) |
| InChIKey | LRPLWQAWPJKIQM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.06 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|