C13H8Br3NO — CID 57379653
2,5-dibromo-N-(2-bromophenyl)benzamide (PubChem CID 57379653) has the molecular formula C13H8Br3NO and a molecular weight of 433.93 g/mol. Its IUPAC name is 2,5-dibromo-N-(2-bromophenyl)benzamide.
| Compound Name | 2,5-dibromo-N-(2-bromophenyl)benzamide |
|---|---|
| PubChem CID | 57379653 |
| Molecular Formula | C13H8Br3NO |
| Molecular Weight | 433.93 g/mol |
| Exact Mass | 430.82 |
| IUPAC Name | 2,5-dibromo-N-(2-bromophenyl)benzamide |
| SMILES | O=C(Nc1ccccc1Br)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C13H8Br3NO/c14-8-5-6-10(15)9(7-8)13(18)17-12-4-2-1-3-11(12)16/h1-7H,(H,17,18) |
| InChIKey | RVAIBSXILRFSPK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.93 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |