C15H12Br2N2O2 — CID 19167014
2,4-dibromo-N'-(2-methylbenzoyl)benzohydrazide (PubChem CID 19167014) has the molecular formula C15H12Br2N2O2 and a molecular weight of 412.08 g/mol. Its IUPAC name is 2,4-dibromo-N'-(2-methylbenzoyl)benzohydrazide.
| Compound Name | 2,4-dibromo-N'-(2-methylbenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 19167014 |
| Molecular Formula | C15H12Br2N2O2 |
| Molecular Weight | 412.08 g/mol |
| Exact Mass | 409.93 |
| IUPAC Name | 2,4-dibromo-N'-(2-methylbenzoyl)benzohydrazide |
| SMILES | Cc1ccccc1C(=O)NNC(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H12Br2N2O2/c1-9-4-2-3-5-11(9)14(20)18-19-15(21)12-7-6-10(16)8-13(12)17/h2-8H,1H3,(H,18,20)(H,19,21) |
| InChIKey | GJSWYZSZHCFYMS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.08 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|