C8H7Br2N3OS — CID 107941941
[(2,4-dibromobenzoyl)amino]thiourea (PubChem CID 107941941) has the molecular formula C8H7Br2N3OS and a molecular weight of 353.04 g/mol. Its IUPAC name is [(2,4-dibromobenzoyl)amino]thiourea.
| Compound Name | [(2,4-dibromobenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 107941941 |
| Molecular Formula | C8H7Br2N3OS |
| Molecular Weight | 353.04 g/mol |
| Exact Mass | 350.87 |
| IUPAC Name | [(2,4-dibromobenzoyl)amino]thiourea |
| SMILES | NC(=S)NNC(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C8H7Br2N3OS/c9-4-1-2-5(6(10)3-4)7(14)12-13-8(11)15/h1-3H,(H,12,14)(H3,11,13,15) |
| InChIKey | XMYACPPRYYJKDR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.04 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|