C14H17F3N4 — CID 116534569
4-(1,2,4-triazol-1-yl)-N-(6,6,6-trifluorohexan-2-yl)aniline (PubChem CID 116534569) has the molecular formula C14H17F3N4 and a molecular weight of 298.31 g/mol. Its IUPAC name is 4-(1,2,4-triazol-1-yl)-N-(6,6,6-trifluorohexan-2-yl)aniline.
| Compound Name | 4-(1,2,4-triazol-1-yl)-N-(6,6,6-trifluorohexan-2-yl)aniline |
|---|---|
| PubChem CID | 116534569 |
| Molecular Formula | C14H17F3N4 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 4-(1,2,4-triazol-1-yl)-N-(6,6,6-trifluorohexan-2-yl)aniline |
| SMILES | CC(CCCC(F)(F)F)Nc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C14H17F3N4/c1-11(3-2-8-14(15,16)17)20-12-4-6-13(7-5-12)21-10-18-9-19-21/h4-7,9-11,20H,2-3,8H2,1H3 |
| InChIKey | ARIFURYUVFXKDZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |