C13H14F3NO — CID 139985627
5,5,5-trifluoro-2-[(4-methoxyphenyl)methyl]pentanenitrile (PubChem CID 139985627) has the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. Its IUPAC name is 5,5,5-trifluoro-2-[(4-methoxyphenyl)methyl]pentanenitrile.
| Compound Name | 5,5,5-trifluoro-2-[(4-methoxyphenyl)methyl]pentanenitrile |
|---|---|
| PubChem CID | 139985627 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 5,5,5-trifluoro-2-[(4-methoxyphenyl)methyl]pentanenitrile |
| SMILES | COc1ccc(CC(C#N)CCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3NO/c1-18-12-4-2-10(3-5-12)8-11(9-17)6-7-13(14,15)16/h2-5,11H,6-8H2,1H3 |
| InChIKey | BRCFZENKYXKAJB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |