C12H12F3N — CID 116996850
2-[[4-(trifluoromethyl)phenyl]methyl]butanenitrile (PubChem CID 116996850) has the molecular formula C12H12F3N and a molecular weight of 227.23 g/mol. Its IUPAC name is 2-[[4-(trifluoromethyl)phenyl]methyl]butanenitrile.
| Compound Name | 2-[[4-(trifluoromethyl)phenyl]methyl]butanenitrile |
|---|---|
| PubChem CID | 116996850 |
| Molecular Formula | C12H12F3N |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2-[[4-(trifluoromethyl)phenyl]methyl]butanenitrile |
| SMILES | CCC(C#N)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H12F3N/c1-2-9(8-16)7-10-3-5-11(6-4-10)12(13,14)15/h3-6,9H,2,7H2,1H3 |
| InChIKey | QDKCFMJJTZLFNJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |