C17H18F3N — CID 115803330
2-(4-ethylphenyl)-1-[4-(trifluoromethyl)phenyl]ethanamine (PubChem CID 115803330) has the molecular formula C17H18F3N and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-1-[4-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 2-(4-ethylphenyl)-1-[4-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 115803330 |
| Molecular Formula | C17H18F3N |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-(4-ethylphenyl)-1-[4-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CCc1ccc(CC(N)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H18F3N/c1-2-12-3-5-13(6-4-12)11-16(21)14-7-9-15(10-8-14)17(18,19)20/h3-10,16H,2,11,21H2,1H3 |
| InChIKey | VIXRDVMZQQCMFD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |