C16H15ClF3N — CID 81316901
1-(3-chloro-5-methylphenyl)-2-[4-(trifluoromethyl)phenyl]ethanamine (PubChem CID 81316901) has the molecular formula C16H15ClF3N and a molecular weight of 313.75 g/mol. Its IUPAC name is 1-(3-chloro-5-methylphenyl)-2-[4-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 1-(3-chloro-5-methylphenyl)-2-[4-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 81316901 |
| Molecular Formula | C16H15ClF3N |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 1-(3-chloro-5-methylphenyl)-2-[4-(trifluoromethyl)phenyl]ethanamine |
| SMILES | Cc1cc(Cl)cc(C(N)Cc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C16H15ClF3N/c1-10-6-12(9-14(17)7-10)15(21)8-11-2-4-13(5-3-11)16(18,19)20/h2-7,9,15H,8,21H2,1H3 |
| InChIKey | KQPIZCUMDZVGPC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |