C16H24F3NO — CID 79959286
6,6,6-trifluoro-1-(4-methoxyphenyl)-N-propylhexan-3-amine (PubChem CID 79959286) has the molecular formula C16H24F3NO and a molecular weight of 303.37 g/mol. Its IUPAC name is 6,6,6-trifluoro-1-(4-methoxyphenyl)-N-propylhexan-3-amine.
| Compound Name | 6,6,6-trifluoro-1-(4-methoxyphenyl)-N-propylhexan-3-amine |
|---|---|
| PubChem CID | 79959286 |
| Molecular Formula | C16H24F3NO |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 6,6,6-trifluoro-1-(4-methoxyphenyl)-N-propylhexan-3-amine |
| SMILES | CCCNC(CCc1ccc(OC)cc1)CCC(F)(F)F |
| InChI | InChI=1S/C16H24F3NO/c1-3-12-20-14(10-11-16(17,18)19)7-4-13-5-8-15(21-2)9-6-13/h5-6,8-9,14,20H,3-4,7,10-12H2,1-2H3 |
| InChIKey | AXYQPLVVARHHGM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |