C19H33NO — CID 115845424
1-(4-methoxyphenyl)-5-methyl-N-propyloctan-3-amine (PubChem CID 115845424) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-5-methyl-N-propyloctan-3-amine.
| Compound Name | 1-(4-methoxyphenyl)-5-methyl-N-propyloctan-3-amine |
|---|---|
| PubChem CID | 115845424 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 1-(4-methoxyphenyl)-5-methyl-N-propyloctan-3-amine |
| SMILES | CCCNC(CCc1ccc(OC)cc1)CC(C)CCC |
| InChI | InChI=1S/C19H33NO/c1-5-7-16(3)15-18(20-14-6-2)11-8-17-9-12-19(21-4)13-10-17/h9-10,12-13,16,18,20H,5-8,11,14-15H2,1-4H3 |
| InChIKey | UCDRCXKMSYGOOB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |