C20H26O4 — CID 165355377
7-(4-hydroxyphenyl)-1-(4-methoxyphenyl)heptane-1,5-diol (PubChem CID 165355377) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 7-(4-hydroxyphenyl)-1-(4-methoxyphenyl)heptane-1,5-diol.
| Compound Name | 7-(4-hydroxyphenyl)-1-(4-methoxyphenyl)heptane-1,5-diol |
|---|---|
| PubChem CID | 165355377 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 7-(4-hydroxyphenyl)-1-(4-methoxyphenyl)heptane-1,5-diol |
| SMILES | COc1ccc(C(O)CCCC(O)CCc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C20H26O4/c1-24-19-13-8-16(9-14-19)20(23)4-2-3-17(21)10-5-15-6-11-18(22)12-7-15/h6-9,11-14,17,20-23H,2-5,10H2,1H3 |
| InChIKey | JXXKDKDHJQUNMF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |