C12H20O11P2 — CID 87392677
[2-(4-hydroxy-3-propan-2-yloxyphenoxy)-3-phosphonooxypropyl] dihydrogen phosphate (PubChem CID 87392677) has the molecular formula C12H20O11P2 and a molecular weight of 402.23 g/mol. Its IUPAC name is [2-(4-hydroxy-3-propan-2-yloxyphenoxy)-3-phosphonooxypropyl] dihydrogen phosphate.
| Compound Name | [2-(4-hydroxy-3-propan-2-yloxyphenoxy)-3-phosphonooxypropyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87392677 |
| Molecular Formula | C12H20O11P2 |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | [2-(4-hydroxy-3-propan-2-yloxyphenoxy)-3-phosphonooxypropyl] dihydrogen phosphate |
| SMILES | CC(C)Oc1cc(OC(COP(=O)(O)O)COP(=O)(O)O)ccc1O |
| InChI | InChI=1S/C12H20O11P2/c1-8(2)22-12-5-9(3-4-11(12)13)23-10(6-20-24(14,15)16)7-21-25(17,18)19/h3-5,8,10,13H,6-7H2,1-2H3,(H2,14,15,16)(H2,17,18,19) |
| InChIKey | UJFOBCUMKPEQPD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 172.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|