C12H18O5 — CID 77231109
2-(4-hydroxy-3-propan-2-yloxyphenoxy)propane-1,3-diol (PubChem CID 77231109) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-(4-hydroxy-3-propan-2-yloxyphenoxy)propane-1,3-diol.
| Compound Name | 2-(4-hydroxy-3-propan-2-yloxyphenoxy)propane-1,3-diol |
|---|---|
| PubChem CID | 77231109 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-(4-hydroxy-3-propan-2-yloxyphenoxy)propane-1,3-diol |
| SMILES | CC(C)Oc1cc(OC(CO)CO)ccc1O |
| InChI | InChI=1S/C12H18O5/c1-8(2)16-12-5-9(3-4-11(12)15)17-10(6-13)7-14/h3-5,8,10,13-15H,6-7H2,1-2H3 |
| InChIKey | WWMXIYFTKNDMRK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |