About N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine;hydrochloride
N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine;hydrochloride (PubChem CID 134137504) has the molecular formula C21H35ClN2O3
and a molecular weight of 398.98 g/mol. Its IUPAC name is N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine;hydrochloride |
| PubChem CID | 134137504 |
| Molecular Formula | C21H35ClN2O3 |
| Molecular Weight | 398.98 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine;hydrochloride |
| SMILES | COc1ccc(CCCNC2CCCCC2N2CCOCC2)cc1OC.Cl |
| InChI | InChI=1S/C21H34N2O3.ClH/c1-24-20-10-9-17(16-21(20)25-2)6-5-11-22-18-7-3-4-8-19(18)23-12-14-26-15-13-23;/h9-10,16,18-19,22H,3-8,11-15H2,1-2H3;1H |
| InChIKey | IWNZRSRZIFRVOU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.98 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine;hydrochloride?
The IUPAC name of N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine;hydrochloride (CID 134137504) is N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine;hydrochloride.
What is the SMILES notation for N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine;hydrochloride?
The canonical SMILES for N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine;hydrochloride is COc1ccc(CCCNC2CCCCC2N2CCOCC2)cc1OC.Cl.
What is the InChIKey of N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine;hydrochloride?
The InChIKey is IWNZRSRZIFRVOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34N2O3.ClH/c1-24-20-10-9-17(16-21(20)25-2)6-5-11-22-18-7-3-4-8-19(18)23-12-14-26-15-13-23;/h9-10,16,18-19,22H,3-8,11-15H2,1-2H3;1H.
What are the key properties of N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine;hydrochloride?
N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine;hydrochloride has a molecular weight of 398.98 g/mol, XLogP of 3.29, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine;hydrochloride is sourced from PubChem (CID 134137504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).