C21H34N2O3 — CID 58952610
(1S)-N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine (PubChem CID 58952610) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is (1S)-N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine.
| Compound Name | (1S)-N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 58952610 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | (1S)-N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine |
| SMILES | COc1ccc(CCCN[C@H]2CCCCC2N2CCOCC2)cc1OC |
| InChI | InChI=1S/C21H34N2O3/c1-24-20-10-9-17(16-21(20)25-2)6-5-11-22-18-7-3-4-8-19(18)23-12-14-26-15-13-23/h9-10,16,18-19,22H,3-8,11-15H2,1-2H3/t18-,19?/m0/s1 |
| InChIKey | VCXYAFYYEPQPBY-OYKVQYDMSA-N |
| XLogP | 2.87 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|