C16H28N2O2+2 — CID 7021849
2-(3,4-dimethoxyphenyl)ethyl-(1-methylpiperidin-1-ium-4-yl)azanium (PubChem CID 7021849) has the molecular formula C16H28N2O2+2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethyl-(1-methylpiperidin-1-ium-4-yl)azanium.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethyl-(1-methylpiperidin-1-ium-4-yl)azanium |
|---|---|
| PubChem CID | 7021849 |
| Molecular Formula | C16H28N2O2+2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.21 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethyl-(1-methylpiperidin-1-ium-4-yl)azanium |
| SMILES | COc1ccc(CC[NH2+]C2CC[NH+](C)CC2)cc1OC |
| InChI | InChI=1S/C16H26N2O2/c1-18-10-7-14(8-11-18)17-9-6-13-4-5-15(19-2)16(12-13)20-3/h4-5,12,14,17H,6-11H2,1-3H3/p+2 |
| InChIKey | CWENNUNXHJSJRK-UHFFFAOYSA-P |
| XLogP | -0.51 |
| TPSA | 39.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |