C16H28N2O+2 — CID 2173496
(4-methoxy-3-methylphenyl)methyl-methyl-(1-methylpiperidin-1-ium-4-yl)azanium (PubChem CID 2173496) has the molecular formula C16H28N2O+2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (4-methoxy-3-methylphenyl)methyl-methyl-(1-methylpiperidin-1-ium-4-yl)azanium.
| Compound Name | (4-methoxy-3-methylphenyl)methyl-methyl-(1-methylpiperidin-1-ium-4-yl)azanium |
|---|---|
| PubChem CID | 2173496 |
| Molecular Formula | C16H28N2O+2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | (4-methoxy-3-methylphenyl)methyl-methyl-(1-methylpiperidin-1-ium-4-yl)azanium |
| SMILES | COc1ccc(C[NH+](C)C2CC[NH+](C)CC2)cc1C |
| InChI | InChI=1S/C16H26N2O/c1-13-11-14(5-6-16(13)19-4)12-18(3)15-7-9-17(2)10-8-15/h5-6,11,15H,7-10,12H2,1-4H3/p+2 |
| InChIKey | JVMMMNPBTDPIQB-UHFFFAOYSA-P |
| XLogP | -0.30 |
| TPSA | 18.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|