C15H17Cl2NO2S — CID 62841532
1-(2,6-dichlorophenoxy)-3-(1-thiophen-3-ylethylamino)propan-2-ol (PubChem CID 62841532) has the molecular formula C15H17Cl2NO2S and a molecular weight of 346.28 g/mol. Its IUPAC name is 1-(2,6-dichlorophenoxy)-3-(1-thiophen-3-ylethylamino)propan-2-ol.
| Compound Name | 1-(2,6-dichlorophenoxy)-3-(1-thiophen-3-ylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 62841532 |
| Molecular Formula | C15H17Cl2NO2S |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 1-(2,6-dichlorophenoxy)-3-(1-thiophen-3-ylethylamino)propan-2-ol |
| SMILES | CC(NCC(O)COc1c(Cl)cccc1Cl)c1ccsc1 |
| InChI | InChI=1S/C15H17Cl2NO2S/c1-10(11-5-6-21-9-11)18-7-12(19)8-20-15-13(16)3-2-4-14(15)17/h2-6,9-10,12,18-19H,7-8H2,1H3 |
| InChIKey | SATYFYFSLYRGIT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |