C24H23ClN2O4S — CID 2133944
4-chloro-N-ethyl-N-[(2S)-3-(fluoren-9-ylideneamino)oxy-2-hydroxypropyl]benzenesulfonamide (PubChem CID 2133944) has the molecular formula C24H23ClN2O4S and a molecular weight of 470.98 g/mol. Its IUPAC name is 4-chloro-N-ethyl-N-[(2S)-3-(fluoren-9-ylideneamino)oxy-2-hydroxypropyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-ethyl-N-[(2S)-3-(fluoren-9-ylideneamino)oxy-2-hydroxypropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2133944 |
| Molecular Formula | C24H23ClN2O4S |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 4-chloro-N-ethyl-N-[(2S)-3-(fluoren-9-ylideneamino)oxy-2-hydroxypropyl]benzenesulfonamide |
| SMILES | CCN(C[C@H](O)CON=C1c2ccccc2-c2ccccc21)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23ClN2O4S/c1-2-27(32(29,30)19-13-11-17(25)12-14-19)15-18(28)16-31-26-24-22-9-5-3-7-20(22)21-8-4-6-10-23(21)24/h3-14,18,28H,2,15-16H2,1H3/t18-/m0/s1 |
| InChIKey | KICXLWMTAFXBEJ-SFHVURJKSA-N |
| XLogP | 4.16 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|