C15H24N2O3S — CID 141074930
N-ethyl-N-(2-hydroxy-3-pyrrolidin-1-ylpropyl)benzenesulfonamide (PubChem CID 141074930) has the molecular formula C15H24N2O3S and a molecular weight of 312.43 g/mol. Its IUPAC name is N-ethyl-N-(2-hydroxy-3-pyrrolidin-1-ylpropyl)benzenesulfonamide.
| Compound Name | N-ethyl-N-(2-hydroxy-3-pyrrolidin-1-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 141074930 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-ethyl-N-(2-hydroxy-3-pyrrolidin-1-ylpropyl)benzenesulfonamide |
| SMILES | CCN(CC(O)CN1CCCC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H24N2O3S/c1-2-17(13-14(18)12-16-10-6-7-11-16)21(19,20)15-8-4-3-5-9-15/h3-5,8-9,14,18H,2,6-7,10-13H2,1H3 |
| InChIKey | NXYWEZOJVCKOML-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |