C21H27N3O6S — CID 1125517
N-[(2S)-2-hydroxy-3-piperidin-1-ylpropyl]-N-(2-methoxy-5-nitrophenyl)benzenesulfonamide (PubChem CID 1125517) has the molecular formula C21H27N3O6S and a molecular weight of 449.53 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-3-piperidin-1-ylpropyl]-N-(2-methoxy-5-nitrophenyl)benzenesulfonamide.
| Compound Name | N-[(2S)-2-hydroxy-3-piperidin-1-ylpropyl]-N-(2-methoxy-5-nitrophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 1125517 |
| Molecular Formula | C21H27N3O6S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-[(2S)-2-hydroxy-3-piperidin-1-ylpropyl]-N-(2-methoxy-5-nitrophenyl)benzenesulfonamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1N(C[C@@H](O)CN1CCCCC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H27N3O6S/c1-30-21-11-10-17(24(26)27)14-20(21)23(31(28,29)19-8-4-2-5-9-19)16-18(25)15-22-12-6-3-7-13-22/h2,4-5,8-11,14,18,25H,3,6-7,12-13,15-16H2,1H3/t18-/m0/s1 |
| InChIKey | HLJACWICPMCAEP-SFHVURJKSA-N |
| XLogP | 2.65 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|