C20H26ClN3O5S — CID 52998314
N-(2-hydroxy-3-piperidin-1-ylpropyl)-N-(4-nitrophenyl)benzenesulfonamide;hydrochloride (PubChem CID 52998314) has the molecular formula C20H26ClN3O5S and a molecular weight of 455.96 g/mol. Its IUPAC name is N-(2-hydroxy-3-piperidin-1-ylpropyl)-N-(4-nitrophenyl)benzenesulfonamide;hydrochloride.
| Compound Name | N-(2-hydroxy-3-piperidin-1-ylpropyl)-N-(4-nitrophenyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 52998314 |
| Molecular Formula | C20H26ClN3O5S |
| Molecular Weight | 455.96 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-(2-hydroxy-3-piperidin-1-ylpropyl)-N-(4-nitrophenyl)benzenesulfonamide;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(N(CC(O)CN2CCCCC2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H25N3O5S.ClH/c24-19(15-21-13-5-2-6-14-21)16-22(17-9-11-18(12-10-17)23(25)26)29(27,28)20-7-3-1-4-8-20;/h1,3-4,7-12,19,24H,2,5-6,13-16H2;1H |
| InChIKey | WZPSYZQZVRJBSW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.96 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|