C30H30N2O4S — CID 30169640
2-[N-(benzenesulfonyl)-4-ethoxyanilino]-N,N-dibenzylacetamide (PubChem CID 30169640) has the molecular formula C30H30N2O4S and a molecular weight of 514.65 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-ethoxyanilino]-N,N-dibenzylacetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-ethoxyanilino]-N,N-dibenzylacetamide |
|---|---|
| PubChem CID | 30169640 |
| Molecular Formula | C30H30N2O4S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-ethoxyanilino]-N,N-dibenzylacetamide |
| SMILES | CCOc1ccc(N(CC(=O)N(Cc2ccccc2)Cc2ccccc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H30N2O4S/c1-2-36-28-20-18-27(19-21-28)32(37(34,35)29-16-10-5-11-17-29)24-30(33)31(22-25-12-6-3-7-13-25)23-26-14-8-4-9-15-26/h3-21H,2,22-24H2,1H3 |
| InChIKey | SYTUXYWWGDLZAN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |