C33H41N3O5S — CID 100523005
(2S)-2-[[2-[N-(benzenesulfonyl)-4-ethoxyanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide (PubChem CID 100523005) has the molecular formula C33H41N3O5S and a molecular weight of 591.77 g/mol. Its IUPAC name is (2S)-2-[[2-[N-(benzenesulfonyl)-4-ethoxyanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide.
| Compound Name | (2S)-2-[[2-[N-(benzenesulfonyl)-4-ethoxyanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100523005 |
| Molecular Formula | C33H41N3O5S |
| Molecular Weight | 591.77 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | (2S)-2-[[2-[N-(benzenesulfonyl)-4-ethoxyanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide |
| SMILES | CCOc1ccc(N(CC(=O)N(Cc2ccccc2)[C@@H](CC)C(=O)NC2CCCCC2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H41N3O5S/c1-3-31(33(38)34-27-16-10-6-11-17-27)35(24-26-14-8-5-9-15-26)32(37)25-36(28-20-22-29(23-21-28)41-4-2)42(39,40)30-18-12-7-13-19-30/h5,7-9,12-15,18-23,27,31H,3-4,6,10-11,16-17,24-25H2,1-2H3,(H,34,38)/t31-/m0/s1 |
| InChIKey | DVZJZBNFYPYCJK-HKBQPEDESA-N |
| XLogP | 5.54 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.77 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |