C33H41N3O4S — CID 100525274
(2S)-2-[[2-[N-(benzenesulfonyl)-4-ethylanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide (PubChem CID 100525274) has the molecular formula C33H41N3O4S and a molecular weight of 575.78 g/mol. Its IUPAC name is (2S)-2-[[2-[N-(benzenesulfonyl)-4-ethylanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide.
| Compound Name | (2S)-2-[[2-[N-(benzenesulfonyl)-4-ethylanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100525274 |
| Molecular Formula | C33H41N3O4S |
| Molecular Weight | 575.78 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | (2S)-2-[[2-[N-(benzenesulfonyl)-4-ethylanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide |
| SMILES | CCc1ccc(N(CC(=O)N(Cc2ccccc2)[C@@H](CC)C(=O)NC2CCCCC2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H41N3O4S/c1-3-26-20-22-29(23-21-26)36(41(39,40)30-18-12-7-13-19-30)25-32(37)35(24-27-14-8-5-9-15-27)31(4-2)33(38)34-28-16-10-6-11-17-28/h5,7-9,12-15,18-23,28,31H,3-4,6,10-11,16-17,24-25H2,1-2H3,(H,34,38)/t31-/m0/s1 |
| InChIKey | KLAOJTFCPHAYNC-HKBQPEDESA-N |
| XLogP | 5.70 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.78 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |