C37H41N3O5S — CID 100527225
(2S)-2-[[2-[N-(benzenesulfonyl)-4-phenoxyanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide (PubChem CID 100527225) has the molecular formula C37H41N3O5S and a molecular weight of 639.82 g/mol. Its IUPAC name is (2S)-2-[[2-[N-(benzenesulfonyl)-4-phenoxyanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide.
| Compound Name | (2S)-2-[[2-[N-(benzenesulfonyl)-4-phenoxyanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100527225 |
| Molecular Formula | C37H41N3O5S |
| Molecular Weight | 639.82 g/mol |
| Exact Mass | 639.28 |
| IUPAC Name | (2S)-2-[[2-[N-(benzenesulfonyl)-4-phenoxyanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)CN(c1ccc(Oc2ccccc2)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C37H41N3O5S/c1-2-35(37(42)38-30-17-9-4-10-18-30)39(27-29-15-7-3-8-16-29)36(41)28-40(46(43,44)34-21-13-6-14-22-34)31-23-25-33(26-24-31)45-32-19-11-5-12-20-32/h3,5-8,11-16,19-26,30,35H,2,4,9-10,17-18,27-28H2,1H3,(H,38,42)/t35-/m0/s1 |
| InChIKey | LBOLHRQTKJWIEW-DHUJRADRSA-N |
| XLogP | 6.93 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.82 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |