C31H37N3O4S — CID 132626500
2-[[2-[N-(benzenesulfonyl)-4-methylanilino]acetyl]-benzylamino]-N-cyclopentylbutanamide (PubChem CID 132626500) has the molecular formula C31H37N3O4S and a molecular weight of 547.72 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-4-methylanilino]acetyl]-benzylamino]-N-cyclopentylbutanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-4-methylanilino]acetyl]-benzylamino]-N-cyclopentylbutanamide |
|---|---|
| PubChem CID | 132626500 |
| Molecular Formula | C31H37N3O4S |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-4-methylanilino]acetyl]-benzylamino]-N-cyclopentylbutanamide |
| SMILES | CCC(C(=O)NC1CCCC1)N(Cc1ccccc1)C(=O)CN(c1ccc(C)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H37N3O4S/c1-3-29(31(36)32-26-14-10-11-15-26)33(22-25-12-6-4-7-13-25)30(35)23-34(27-20-18-24(2)19-21-27)39(37,38)28-16-8-5-9-17-28/h4-9,12-13,16-21,26,29H,3,10-11,14-15,22-23H2,1-2H3,(H,32,36) |
| InChIKey | RNTBQAWEVOBFCV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |