C33H41N3O4S — CID 132631079
2-[[2-[N-(benzenesulfonyl)-3,4-dimethylanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide (PubChem CID 132631079) has the molecular formula C33H41N3O4S and a molecular weight of 575.78 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-3,4-dimethylanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-3,4-dimethylanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 132631079 |
| Molecular Formula | C33H41N3O4S |
| Molecular Weight | 575.78 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-3,4-dimethylanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)CN(c1ccc(C)c(C)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C33H41N3O4S/c1-4-31(33(38)34-28-16-10-6-11-17-28)35(23-27-14-8-5-9-15-27)32(37)24-36(29-21-20-25(2)26(3)22-29)41(39,40)30-18-12-7-13-19-30/h5,7-9,12-15,18-22,28,31H,4,6,10-11,16-17,23-24H2,1-3H3,(H,34,38) |
| InChIKey | NVCUTYRKPNMSEK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.78 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |