C31H34N2O3S — CID 58990667
N-benzyl-2-[(4-tert-butylphenyl)sulfonyl-naphthalen-2-ylamino]-N-ethylacetamide (PubChem CID 58990667) has the molecular formula C31H34N2O3S and a molecular weight of 514.69 g/mol. Its IUPAC name is N-benzyl-2-[(4-tert-butylphenyl)sulfonyl-naphthalen-2-ylamino]-N-ethylacetamide.
| Compound Name | N-benzyl-2-[(4-tert-butylphenyl)sulfonyl-naphthalen-2-ylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 58990667 |
| Molecular Formula | C31H34N2O3S |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | N-benzyl-2-[(4-tert-butylphenyl)sulfonyl-naphthalen-2-ylamino]-N-ethylacetamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CN(c1ccc2ccccc2c1)S(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C31H34N2O3S/c1-5-32(22-24-11-7-6-8-12-24)30(34)23-33(28-18-15-25-13-9-10-14-26(25)21-28)37(35,36)29-19-16-27(17-20-29)31(2,3)4/h6-21H,5,22-23H2,1-4H3 |
| InChIKey | AMAMPHRXJNFIMD-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |