C27H28N2O10S2 — CID 177380835
3-[2,5-bis[carboxymethyl-(4-methylphenyl)sulfonylamino]phenyl]propanoic acid (PubChem CID 177380835) has the molecular formula C27H28N2O10S2 and a molecular weight of 604.66 g/mol. Its IUPAC name is 3-[2,5-bis[carboxymethyl-(4-methylphenyl)sulfonylamino]phenyl]propanoic acid.
| Compound Name | 3-[2,5-bis[carboxymethyl-(4-methylphenyl)sulfonylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 177380835 |
| Molecular Formula | C27H28N2O10S2 |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.12 |
| IUPAC Name | 3-[2,5-bis[carboxymethyl-(4-methylphenyl)sulfonylamino]phenyl]propanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)O)c2ccc(N(CC(=O)O)S(=O)(=O)c3ccc(C)cc3)c(CCC(=O)O)c2)cc1 |
| InChI | InChI=1S/C27H28N2O10S2/c1-18-3-9-22(10-4-18)40(36,37)28(16-26(32)33)21-8-13-24(20(15-21)7-14-25(30)31)29(17-27(34)35)41(38,39)23-11-5-19(2)6-12-23/h3-6,8-13,15H,7,14,16-17H2,1-2H3,(H,30,31)(H,32,33)(H,34,35) |
| InChIKey | SMTFFKOBIQNPLA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 186.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |