C25H26BrN2NaO4S — CID 146061420
sodium 4-[[(4-bromophenyl)methyl-(4-tert-butylphenyl)sulfonylamino]methyl]-N-oxidobenzamide (PubChem CID 146061420) has the molecular formula C25H26BrN2NaO4S and a molecular weight of 553.45 g/mol. Its IUPAC name is sodium 4-[[(4-bromophenyl)methyl-(4-tert-butylphenyl)sulfonylamino]methyl]-N-oxidobenzamide.
| Compound Name | sodium 4-[[(4-bromophenyl)methyl-(4-tert-butylphenyl)sulfonylamino]methyl]-N-oxidobenzamide |
|---|---|
| PubChem CID | 146061420 |
| Molecular Formula | C25H26BrN2NaO4S |
| Molecular Weight | 553.45 g/mol |
| Exact Mass | 552.07 |
| IUPAC Name | sodium 4-[[(4-bromophenyl)methyl-(4-tert-butylphenyl)sulfonylamino]methyl]-N-oxidobenzamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N(Cc2ccc(Br)cc2)Cc2ccc(C(=O)N[O-])cc2)cc1.[Na+] |
| InChI | InChI=1S/C25H26BrN2O4S.Na/c1-25(2,3)21-10-14-23(15-11-21)33(31,32)28(17-19-6-12-22(26)13-7-19)16-18-4-8-20(9-5-18)24(29)27-30;/h4-15H,16-17H2,1-3H3,(H-,27,29,30);/q-1;+1 |
| InChIKey | VBGNNPQIDYAAMF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|