C20H25BrN2O3S — CID 55778771
N-[1-(4-bromophenyl)propan-2-yl]-4-(diethylsulfamoyl)benzamide (PubChem CID 55778771) has the molecular formula C20H25BrN2O3S and a molecular weight of 453.40 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)propan-2-yl]-4-(diethylsulfamoyl)benzamide.
| Compound Name | N-[1-(4-bromophenyl)propan-2-yl]-4-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55778771 |
| Molecular Formula | C20H25BrN2O3S |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | N-[1-(4-bromophenyl)propan-2-yl]-4-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NC(C)Cc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C20H25BrN2O3S/c1-4-23(5-2)27(25,26)19-12-8-17(9-13-19)20(24)22-15(3)14-16-6-10-18(21)11-7-16/h6-13,15H,4-5,14H2,1-3H3,(H,22,24) |
| InChIKey | HEGLKUCFZIYPDQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |