C18H22BrN3O3S — CID 17448990
5-bromo-N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]pyridine-3-carboxamide (PubChem CID 17448990) has the molecular formula C18H22BrN3O3S and a molecular weight of 440.36 g/mol. Its IUPAC name is 5-bromo-N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 17448990 |
| Molecular Formula | C18H22BrN3O3S |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 5-bromo-N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]pyridine-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(C)NC(=O)c2cncc(Br)c2)cc1 |
| InChI | InChI=1S/C18H22BrN3O3S/c1-4-22(5-2)26(24,25)17-8-6-14(7-9-17)13(3)21-18(23)15-10-16(19)12-20-11-15/h6-13H,4-5H2,1-3H3,(H,21,23) |
| InChIKey | ZPFPKHGJRHUOGO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |