C23H28N4O3S — CID 31367915
N-[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]-4-(5-methylpyrazol-1-yl)benzamide (PubChem CID 31367915) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is N-[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]-4-(5-methylpyrazol-1-yl)benzamide.
| Compound Name | N-[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]-4-(5-methylpyrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 31367915 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N-[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]-4-(5-methylpyrazol-1-yl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc([C@H](C)NC(=O)c2ccc(-n3nccc3C)cc2)cc1 |
| InChI | InChI=1S/C23H28N4O3S/c1-5-26(6-2)31(29,30)22-13-9-19(10-14-22)18(4)25-23(28)20-7-11-21(12-8-20)27-17(3)15-16-24-27/h7-16,18H,5-6H2,1-4H3,(H,25,28)/t18-/m0/s1 |
| InChIKey | LOOMBADAMQNWSE-SFHVURJKSA-N |
| XLogP | 3.70 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |