C17H17N3O2 — CID 9482283
N-[(1R)-1-(furan-2-yl)ethyl]-4-(5-methylpyrazol-1-yl)benzamide (PubChem CID 9482283) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is N-[(1R)-1-(furan-2-yl)ethyl]-4-(5-methylpyrazol-1-yl)benzamide.
| Compound Name | N-[(1R)-1-(furan-2-yl)ethyl]-4-(5-methylpyrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 9482283 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-[(1R)-1-(furan-2-yl)ethyl]-4-(5-methylpyrazol-1-yl)benzamide |
| SMILES | Cc1ccnn1-c1ccc(C(=O)N[C@H](C)c2ccco2)cc1 |
| InChI | InChI=1S/C17H17N3O2/c1-12-9-10-18-20(12)15-7-5-14(6-8-15)17(21)19-13(2)16-4-3-11-22-16/h3-11,13H,1-2H3,(H,19,21)/t13-/m1/s1 |
| InChIKey | FVVYJLKUKYWILV-CYBMUJFWSA-N |
| XLogP | 3.26 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |